C26H26N4O4 — CID 53091095
N-(4-ethoxyphenyl)-4-[2-(2-methylanilino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide (PubChem CID 53091095) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[2-(2-methylanilino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[2-(2-methylanilino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 53091095 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[2-(2-methylanilino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CC(=O)N(CC(=O)Nc3ccccc3C)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N4O4/c1-3-34-20-14-12-19(13-15-20)27-26(33)30-17-25(32)29(22-10-6-7-11-23(22)30)16-24(31)28-21-9-5-4-8-18(21)2/h4-15H,3,16-17H2,1-2H3,(H,27,33)(H,28,31) |
| InChIKey | FWVCUIPEBXKEBY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |