C17H17ClN2O3S — CID 53092459
N-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-2-chlorobenzenesulfonamide (PubChem CID 53092459) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is N-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-2-chlorobenzenesulfonamide.
| Compound Name | N-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 53092459 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-2-chlorobenzenesulfonamide |
| SMILES | CC(=O)N1CCc2cc(CNS(=O)(=O)c3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C17H17ClN2O3S/c1-12(21)20-9-8-14-10-13(6-7-16(14)20)11-19-24(22,23)17-5-3-2-4-15(17)18/h2-7,10,19H,8-9,11H2,1H3 |
| InChIKey | IIHZOLAAMVBRRO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |