C18H24N2O4S — CID 53094869
N-cyclooctyl-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 53094869) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-cyclooctyl-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | N-cyclooctyl-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 53094869 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-cyclooctyl-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | COc1cc(-c2ccno2)ccc1S(=O)(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C18H24N2O4S/c1-23-17-13-14(16-11-12-19-24-16)9-10-18(17)25(21,22)20-15-7-5-3-2-4-6-8-15/h9-13,15,20H,2-8H2,1H3 |
| InChIKey | JBPHXZFWEBRQCZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |