C18H18N2O4S — CID 53094876
N-(4-ethylphenyl)-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 53094876) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | N-(4-ethylphenyl)-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 53094876 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(4-ethylphenyl)-2-methoxy-4-(1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2ccc(-c3ccno3)cc2OC)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-3-13-4-7-15(8-5-13)20-25(21,22)18-9-6-14(12-17(18)23-2)16-10-11-19-24-16/h4-12,20H,3H2,1-2H3 |
| InChIKey | ZHHJOBXNWSTIAV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |