C15H12N6O4 — CID 53095311
5-(5-nitrofuran-2-yl)-3-(1-propylbenzotriazol-5-yl)-1,2,4-oxadiazole (PubChem CID 53095311) has the molecular formula C15H12N6O4 and a molecular weight of 340.30 g/mol. Its IUPAC name is 5-(5-nitrofuran-2-yl)-3-(1-propylbenzotriazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(5-nitrofuran-2-yl)-3-(1-propylbenzotriazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53095311 |
| Molecular Formula | C15H12N6O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-(5-nitrofuran-2-yl)-3-(1-propylbenzotriazol-5-yl)-1,2,4-oxadiazole |
| SMILES | CCCn1nnc2cc(-c3noc(-c4ccc([N+](=O)[O-])o4)n3)ccc21 |
| InChI | InChI=1S/C15H12N6O4/c1-2-7-20-11-4-3-9(8-10(11)17-19-20)14-16-15(25-18-14)12-5-6-13(24-12)21(22)23/h3-6,8H,2,7H2,1H3 |
| InChIKey | NWAHVKCKZLLFNU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 125.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|