C18H18N2O3S — CID 5309656
5-ethyl-2-(morpholine-4-carbonyl)thieno[3,2-c]quinolin-4-one (PubChem CID 5309656) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-ethyl-2-(morpholine-4-carbonyl)thieno[3,2-c]quinolin-4-one.
| Compound Name | 5-ethyl-2-(morpholine-4-carbonyl)thieno[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 5309656 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 5-ethyl-2-(morpholine-4-carbonyl)thieno[3,2-c]quinolin-4-one |
| SMILES | CCn1c(=O)c2cc(C(=O)N3CCOCC3)sc2c2ccccc21 |
| InChI | InChI=1S/C18H18N2O3S/c1-2-20-14-6-4-3-5-12(14)16-13(17(20)21)11-15(24-16)18(22)19-7-9-23-10-8-19/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | DDIJCORLICNGIC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |