C24H23N3O4S — CID 53097042
9-(benzylamino)-8-pyrrolidin-1-ylsulfonyl-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 53097042) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 9-(benzylamino)-8-pyrrolidin-1-ylsulfonyl-5H-benzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 9-(benzylamino)-8-pyrrolidin-1-ylsulfonyl-5H-benzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 53097042 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 9-(benzylamino)-8-pyrrolidin-1-ylsulfonyl-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | O=C1Nc2ccccc2Oc2cc(NCc3ccccc3)c(S(=O)(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C24H23N3O4S/c28-24-18-14-23(32(29,30)27-12-6-7-13-27)20(25-16-17-8-2-1-3-9-17)15-22(18)31-21-11-5-4-10-19(21)26-24/h1-5,8-11,14-15,25H,6-7,12-13,16H2,(H,26,28) |
| InChIKey | QWGJUECJKSLMFN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |