C18H16ClN3O4S — CID 53097906
4-[4-chloro-3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylmorpholine (PubChem CID 53097906) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is 4-[4-chloro-3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-chloro-3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 53097906 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-[4-chloro-3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(Cl)c(-c2nnc(-c3ccccc3)o2)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H16ClN3O4S/c19-16-7-6-14(27(23,24)22-8-10-25-11-9-22)12-15(16)18-21-20-17(26-18)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | URJQLEMKVIRTAD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |