C22H21FN4O — CID 53099047
N-(3-fluorophenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)benzamide (PubChem CID 53099047) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)benzamide.
| Compound Name | N-(3-fluorophenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 53099047 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-(3-fluorophenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cccc(-c2cc(N3CCCCC3)ncn2)c1 |
| InChI | InChI=1S/C22H21FN4O/c23-18-8-5-9-19(13-18)26-22(28)17-7-4-6-16(12-17)20-14-21(25-15-24-20)27-10-2-1-3-11-27/h4-9,12-15H,1-3,10-11H2,(H,26,28) |
| InChIKey | KGSZOXPANLRWJG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |