C28H34N4O4 — CID 53103378
N-(3-morpholin-4-ylpropyl)-2-[1-(2-phenyl-1,3-benzoxazole-5-carbonyl)piperidin-4-yl]acetamide (PubChem CID 53103378) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-[1-(2-phenyl-1,3-benzoxazole-5-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-[1-(2-phenyl-1,3-benzoxazole-5-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 53103378 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-[1-(2-phenyl-1,3-benzoxazole-5-carbonyl)piperidin-4-yl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2ccc3oc(-c4ccccc4)nc3c2)CC1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C28H34N4O4/c33-26(29-11-4-12-31-15-17-35-18-16-31)19-21-9-13-32(14-10-21)28(34)23-7-8-25-24(20-23)30-27(36-25)22-5-2-1-3-6-22/h1-3,5-8,20-21H,4,9-19H2,(H,29,33) |
| InChIKey | DKBBJMPMHAEJEZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|