C31H33N3O3 — CID 53103530
2-[1-[2-(4-methylphenyl)-1,3-benzoxazole-5-carbonyl]piperidin-4-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 53103530) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[1-[2-(4-methylphenyl)-1,3-benzoxazole-5-carbonyl]piperidin-4-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[1-[2-(4-methylphenyl)-1,3-benzoxazole-5-carbonyl]piperidin-4-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 53103530 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-[1-[2-(4-methylphenyl)-1,3-benzoxazole-5-carbonyl]piperidin-4-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1ccc(-c2nc3cc(C(=O)N4CCC(CC(=O)NCCCc5ccccc5)CC4)ccc3o2)cc1 |
| InChI | InChI=1S/C31H33N3O3/c1-22-9-11-25(12-10-22)30-33-27-21-26(13-14-28(27)37-30)31(36)34-18-15-24(16-19-34)20-29(35)32-17-5-8-23-6-3-2-4-7-23/h2-4,6-7,9-14,21,24H,5,8,15-20H2,1H3,(H,32,35) |
| InChIKey | MXBDCHLVRCRBCZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|