C25H35N5O — CID 53107069
N-[2-(azepan-1-yl)ethyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide (PubChem CID 53107069) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53107069 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(-c2cnc(N3CCCC(C(=O)NCCN4CCCCCC4)C3)nc2)cc1 |
| InChI | InChI=1S/C25H35N5O/c1-20-8-10-21(11-9-20)23-17-27-25(28-18-23)30-15-6-7-22(19-30)24(31)26-12-16-29-13-4-2-3-5-14-29/h8-11,17-18,22H,2-7,12-16,19H2,1H3,(H,26,31) |
| InChIKey | KNFNYCRCCMMJIT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |