C26H39N5O — CID 53107035
N-[3-(dipropylamino)propyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide (PubChem CID 53107035) has the molecular formula C26H39N5O and a molecular weight of 437.63 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[3-(dipropylamino)propyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53107035 |
| Molecular Formula | C26H39N5O |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.32 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-1-[5-(4-methylphenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
| SMILES | CCCN(CCC)CCCNC(=O)C1CCCN(c2ncc(-c3ccc(C)cc3)cn2)C1 |
| InChI | InChI=1S/C26H39N5O/c1-4-14-30(15-5-2)16-7-13-27-25(32)23-8-6-17-31(20-23)26-28-18-24(19-29-26)22-11-9-21(3)10-12-22/h9-12,18-19,23H,4-8,13-17,20H2,1-3H3,(H,27,32) |
| InChIKey | JEBZVRYTVWADCV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|