C26H30FN5O — CID 95085490
(3R)-1-[5-(4-fluorophenyl)pyrimidin-2-yl]-N-[3-(N-methylanilino)propyl]piperidine-3-carboxamide (PubChem CID 95085490) has the molecular formula C26H30FN5O and a molecular weight of 447.56 g/mol. Its IUPAC name is (3R)-1-[5-(4-fluorophenyl)pyrimidin-2-yl]-N-[3-(N-methylanilino)propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[5-(4-fluorophenyl)pyrimidin-2-yl]-N-[3-(N-methylanilino)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95085490 |
| Molecular Formula | C26H30FN5O |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (3R)-1-[5-(4-fluorophenyl)pyrimidin-2-yl]-N-[3-(N-methylanilino)propyl]piperidine-3-carboxamide |
| SMILES | CN(CCCNC(=O)[C@@H]1CCCN(c2ncc(-c3ccc(F)cc3)cn2)C1)c1ccccc1 |
| InChI | InChI=1S/C26H30FN5O/c1-31(24-8-3-2-4-9-24)15-6-14-28-25(33)21-7-5-16-32(19-21)26-29-17-22(18-30-26)20-10-12-23(27)13-11-20/h2-4,8-13,17-18,21H,5-7,14-16,19H2,1H3,(H,28,33)/t21-/m1/s1 |
| InChIKey | JWKGCRRDBGQTPA-OAQYLSRUSA-N |
| XLogP | 4.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|