C25H36FN5O — CID 95085750
(3R)-N-[3-(dipropylamino)propyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide (PubChem CID 95085750) has the molecular formula C25H36FN5O and a molecular weight of 441.60 g/mol. Its IUPAC name is (3R)-N-[3-(dipropylamino)propyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(dipropylamino)propyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95085750 |
| Molecular Formula | C25H36FN5O |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | (3R)-N-[3-(dipropylamino)propyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
| SMILES | CCCN(CCC)CCCNC(=O)[C@@H]1CCCN(c2ncc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C25H36FN5O/c1-3-12-30(13-4-2)14-7-11-27-24(32)21-9-6-15-31(19-21)25-28-17-22(18-29-25)20-8-5-10-23(26)16-20/h5,8,10,16-18,21H,3-4,6-7,9,11-15,19H2,1-2H3,(H,27,32)/t21-/m1/s1 |
| InChIKey | MZZPZROMFUDVPF-OAQYLSRUSA-N |
| XLogP | 4.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|