C24H29FN4O — CID 53107081
N-[2-(cyclohexen-1-yl)ethyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide (PubChem CID 53107081) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53107081 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[5-(3-fluorophenyl)pyrimidin-2-yl]piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCCN(c2ncc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C24H29FN4O/c25-22-10-4-8-19(14-22)21-15-27-24(28-16-21)29-13-5-9-20(17-29)23(30)26-12-11-18-6-2-1-3-7-18/h4,6,8,10,14-16,20H,1-3,5,7,9,11-13,17H2,(H,26,30) |
| InChIKey | SDGVMKVXTALJCP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|