C21H27N5O — CID 95100843
(3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide (PubChem CID 95100843) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95100843 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)[C@H]1CCCN(c2cnc3nccnc3c2)C1 |
| InChI | InChI=1S/C21H27N5O/c27-21(24-9-8-16-5-2-1-3-6-16)17-7-4-12-26(15-17)18-13-19-20(25-14-18)23-11-10-22-19/h5,10-11,13-14,17H,1-4,6-9,12,15H2,(H,24,27)/t17-/m0/s1 |
| InChIKey | ZKUYDUDQTKJGKG-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|