C25H32N4O2 — CID 50836140
N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide (PubChem CID 50836140) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50836140 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1Oc1nccnc1N1CCCC(C(=O)NCCC2=CCCCC2)C1 |
| InChI | InChI=1S/C25H32N4O2/c1-19-8-5-6-12-22(19)31-25-23(26-15-16-28-25)29-17-7-11-21(18-29)24(30)27-14-13-20-9-3-2-4-10-20/h5-6,8-9,12,15-16,21H,2-4,7,10-11,13-14,17-18H2,1H3,(H,27,30) |
| InChIKey | SRCZCZQYFANNJS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|