C26H28N4O4 — CID 46392484
ethyl 3-[[1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 46392484) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is ethyl 3-[[1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 46392484 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl 3-[[1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C2CCCN(c3nccnc3Oc3ccccc3C)C2)c1 |
| InChI | InChI=1S/C26H28N4O4/c1-3-33-26(32)19-9-6-11-21(16-19)29-24(31)20-10-7-15-30(17-20)23-25(28-14-13-27-23)34-22-12-5-4-8-18(22)2/h4-6,8-9,11-14,16,20H,3,7,10,15,17H2,1-2H3,(H,29,31) |
| InChIKey | NVAFIULJMYFXSR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |