C17H23N5O2 — CID 95100846
(3S)-N-(3-methoxypropyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide (PubChem CID 95100846) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3S)-N-(3-methoxypropyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-methoxypropyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95100846 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (3S)-N-(3-methoxypropyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CCCN(c2cnc3nccnc3c2)C1 |
| InChI | InChI=1S/C17H23N5O2/c1-24-9-3-5-20-17(23)13-4-2-8-22(12-13)14-10-15-16(21-11-14)19-7-6-18-15/h6-7,10-11,13H,2-5,8-9,12H2,1H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | GIAJAQRWQNDATR-ZDUSSCGKSA-N |
| XLogP | 1.39 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|