C14H9N3O3S2 — CID 53111985
N-(3-cyanophenyl)-5-(1,2-oxazol-5-yl)thiophene-2-sulfonamide (PubChem CID 53111985) has the molecular formula C14H9N3O3S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-(1,2-oxazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3-cyanophenyl)-5-(1,2-oxazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53111985 |
| Molecular Formula | C14H9N3O3S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-(3-cyanophenyl)-5-(1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| SMILES | N#Cc1cccc(NS(=O)(=O)c2ccc(-c3ccno3)s2)c1 |
| InChI | InChI=1S/C14H9N3O3S2/c15-9-10-2-1-3-11(8-10)17-22(18,19)14-5-4-13(21-14)12-6-7-16-20-12/h1-8,17H |
| InChIKey | XPJGUTLXKIAENO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |