C14H18O3 — CID 5311454
(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol (PubChem CID 5311454) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol |
|---|---|
| PubChem CID | 5311454 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol |
| SMILES | CC(C)(C)C(O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)13(15)7-5-10-4-6-11-12(8-10)17-9-16-11/h4-8,13,15H,9H2,1-3H3/b7-5+ |
| InChIKey | IBLNKMRFIPWSOY-FNORWQNLSA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |