About Piperonyl alcohol
Piperonyl alcohol (PubChem CID 10322) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethanol.
Molecular Properties
| Compound Name | Piperonyl alcohol |
| PubChem CID | 10322 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethanol |
| SMILES | C1OC2=C(O1)C=C(C=C2)CO |
| InChI | InChI=1S/C8H8O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3,9H,4-5H2 |
| InChIKey | BHUIUXNAPJIDOG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 137 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Piperonyl alcohol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Piperonyl alcohol?
The IUPAC name of Piperonyl alcohol (CID 10322) is 1,3-benzodioxol-5-ylmethanol.
What is the SMILES notation for Piperonyl alcohol?
The canonical SMILES for Piperonyl alcohol is C1OC2=C(O1)C=C(C=C2)CO.
What is the InChIKey of Piperonyl alcohol?
The InChIKey is BHUIUXNAPJIDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3,9H,4-5H2.
What are the key properties of Piperonyl alcohol?
Piperonyl alcohol has a molecular weight of 152.15 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Piperonyl alcohol is sourced from PubChem (CID 10322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).