About 1,3-benzodioxol-5-ylmethyl acetate
1,3-benzodioxol-5-ylmethyl acetate (PubChem CID 9473) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl acetate.
Molecular Properties
| Compound Name | 1,3-benzodioxol-5-ylmethyl acetate |
| PubChem CID | 9473 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl acetate |
| SMILES | CC(=O)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10O4/c1-7(11)12-5-8-2-3-9-10(4-8)14-6-13-9/h2-4H,5-6H2,1H3 |
| InChIKey | PFWYHTORQZAGCA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzodioxol-5-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzodioxol-5-ylmethyl acetate?
The IUPAC name of 1,3-benzodioxol-5-ylmethyl acetate (CID 9473) is 1,3-benzodioxol-5-ylmethyl acetate.
What is the SMILES notation for 1,3-benzodioxol-5-ylmethyl acetate?
The canonical SMILES for 1,3-benzodioxol-5-ylmethyl acetate is CC(=O)OCc1ccc2c(c1)OCO2.
What is the InChIKey of 1,3-benzodioxol-5-ylmethyl acetate?
The InChIKey is PFWYHTORQZAGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-7(11)12-5-8-2-3-9-10(4-8)14-6-13-9/h2-4H,5-6H2,1H3.
What are the key properties of 1,3-benzodioxol-5-ylmethyl acetate?
1,3-benzodioxol-5-ylmethyl acetate has a molecular weight of 194.19 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxol-5-ylmethyl acetate is sourced from PubChem (CID 9473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).