C20H22N4O5S — CID 53115398
3-[(4-ethoxyphenyl)sulfamoyl]-N-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 53115398) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfamoyl]-N-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfamoyl]-N-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115398 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfamoyl]-N-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2n[nH]c(C)c2C(=O)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H22N4O5S/c1-4-29-15-11-9-14(10-12-15)24-30(26,27)20-18(13(2)22-23-20)19(25)21-16-7-5-6-8-17(16)28-3/h5-12,24H,4H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | WXFZUZADXNGLEG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |