C24H35N3O2 — CID 53117764
azepan-1-yl-[1-[(1-ethyl-5-methoxyindol-3-yl)methyl]piperidin-4-yl]methanone (PubChem CID 53117764) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is azepan-1-yl-[1-[(1-ethyl-5-methoxyindol-3-yl)methyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[(1-ethyl-5-methoxyindol-3-yl)methyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 53117764 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | azepan-1-yl-[1-[(1-ethyl-5-methoxyindol-3-yl)methyl]piperidin-4-yl]methanone |
| SMILES | CCn1cc(CN2CCC(C(=O)N3CCCCCC3)CC2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C24H35N3O2/c1-3-26-18-20(22-16-21(29-2)8-9-23(22)26)17-25-14-10-19(11-15-25)24(28)27-12-6-4-5-7-13-27/h8-9,16,18-19H,3-7,10-15,17H2,1-2H3 |
| InChIKey | QMGQKOPWEWCZNP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |