C27H35N3O2 — CID 53117767
1-[(1-ethyl-5-methoxyindol-3-yl)methyl]-N-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 53117767) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[(1-ethyl-5-methoxyindol-3-yl)methyl]-N-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(1-ethyl-5-methoxyindol-3-yl)methyl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53117767 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 1-[(1-ethyl-5-methoxyindol-3-yl)methyl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | CCn1cc(CN2CCC(C(=O)NCCCc3ccccc3)CC2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C27H35N3O2/c1-3-30-20-23(25-18-24(32-2)11-12-26(25)30)19-29-16-13-22(14-17-29)27(31)28-15-7-10-21-8-5-4-6-9-21/h4-6,8-9,11-12,18,20,22H,3,7,10,13-17,19H2,1-2H3,(H,28,31) |
| InChIKey | UIAHFQOGFXPPFU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|