C26H40N4O2 — CID 93061536
1-[(5-methoxy-1-methylindol-3-yl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 93061536) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-[(5-methoxy-1-methylindol-3-yl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(5-methoxy-1-methylindol-3-yl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 93061536 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | 1-[(5-methoxy-1-methylindol-3-yl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2c(c1)c(CN1CCC(C(=O)NCCCN3CCCC[C@@H]3C)CC1)cn2C |
| InChI | InChI=1S/C26H40N4O2/c1-20-7-4-5-13-30(20)14-6-12-27-26(31)21-10-15-29(16-11-21)19-22-18-28(2)25-9-8-23(32-3)17-24(22)25/h8-9,17-18,20-21H,4-7,10-16,19H2,1-3H3,(H,27,31)/t20-/m0/s1 |
| InChIKey | CHIPIWXMPJKCOM-FQEVSTJZSA-N |
| XLogP | 3.78 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|