C18H31N3O5S — CID 53118710
2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 53118710) has the molecular formula C18H31N3O5S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 53118710 |
| Molecular Formula | C18H31N3O5S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(CC(=O)NCCCOC(C)C)CC1 |
| InChI | InChI=1S/C18H31N3O5S/c1-13(2)25-11-5-8-19-17(22)12-16-6-9-21(10-7-16)27(23,24)18-14(3)20-26-15(18)4/h13,16H,5-12H2,1-4H3,(H,19,22) |
| InChIKey | XBGNXIPUJPFJJS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|