C20H34N4O4S — CID 95088604
(2R)-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide (PubChem CID 95088604) has the molecular formula C20H34N4O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is (2R)-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide.
| Compound Name | (2R)-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 95088604 |
| Molecular Formula | C20H34N4O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (2R)-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC([C@@H](C)C(=O)NCCCN2CCCC2)CC1 |
| InChI | InChI=1S/C20H34N4O4S/c1-15(20(25)21-9-6-12-23-10-4-5-11-23)18-7-13-24(14-8-18)29(26,27)19-16(2)22-28-17(19)3/h15,18H,4-14H2,1-3H3,(H,21,25)/t15-/m1/s1 |
| InChIKey | GZZLILKGTYBVTO-OAHLLOKOSA-N |
| XLogP | 1.93 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|