C24H35N3O5S — CID 95088645
(2R)-N-[(4-butoxyphenyl)methyl]-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]propanamide (PubChem CID 95088645) has the molecular formula C24H35N3O5S and a molecular weight of 477.63 g/mol. Its IUPAC name is (2R)-N-[(4-butoxyphenyl)methyl]-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]propanamide.
| Compound Name | (2R)-N-[(4-butoxyphenyl)methyl]-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 95088645 |
| Molecular Formula | C24H35N3O5S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (2R)-N-[(4-butoxyphenyl)methyl]-2-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]propanamide |
| SMILES | CCCCOc1ccc(CNC(=O)[C@H](C)C2CCN(S(=O)(=O)c3c(C)noc3C)CC2)cc1 |
| InChI | InChI=1S/C24H35N3O5S/c1-5-6-15-31-22-9-7-20(8-10-22)16-25-24(28)17(2)21-11-13-27(14-12-21)33(29,30)23-18(3)26-32-19(23)4/h7-10,17,21H,5-6,11-16H2,1-4H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | ICUPVMAPZDMRGR-QGZVFWFLSA-N |
| XLogP | 3.82 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|