C28H27N3O4 — CID 53122934
N-[(2-ethoxyphenyl)methyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 53122934) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53122934 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCOc1ccccc1CNC(=O)c1ncoc1-c1ccccc1C(=O)N(CC)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O4/c1-3-31(21-13-6-5-7-14-21)28(33)23-16-10-9-15-22(23)26-25(30-19-35-26)27(32)29-18-20-12-8-11-17-24(20)34-4-2/h5-17,19H,3-4,18H2,1-2H3,(H,29,32) |
| InChIKey | HOJLLRRTWRNEEG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|