C27H29N3O3 — CID 53122930
N-[2-(cyclohexen-1-yl)ethyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 53122930) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53122930 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[2-[ethyl(phenyl)carbamoyl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCN(C(=O)c1ccccc1-c1ocnc1C(=O)NCCC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O3/c1-2-30(21-13-7-4-8-14-21)27(32)23-16-10-9-15-22(23)25-24(29-19-33-25)26(31)28-18-17-20-11-5-3-6-12-20/h4,7-11,13-16,19H,2-3,5-6,12,17-18H2,1H3,(H,28,31) |
| InChIKey | NPEUWGYOWZZBGI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|