C28H27N5O3 — CID 53011665
N-ethyl-N-phenyl-2-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-oxazol-5-yl]benzamide (PubChem CID 53011665) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-ethyl-N-phenyl-2-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-oxazol-5-yl]benzamide.
| Compound Name | N-ethyl-N-phenyl-2-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 53011665 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-ethyl-N-phenyl-2-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-oxazol-5-yl]benzamide |
| SMILES | CCN(C(=O)c1ccccc1-c1ocnc1C(=O)N1CCN(c2ccccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H27N5O3/c1-2-33(21-10-4-3-5-11-21)27(34)23-13-7-6-12-22(23)26-25(30-20-36-26)28(35)32-18-16-31(17-19-32)24-14-8-9-15-29-24/h3-15,20H,2,16-19H2,1H3 |
| InChIKey | JHOKXEHPMWRZSC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|