C26H27FN6O — CID 53126785
5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridin-2-amine (PubChem CID 53126785) has the molecular formula C26H27FN6O and a molecular weight of 458.54 g/mol. Its IUPAC name is 5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridin-2-amine.
| Compound Name | 5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 53126785 |
| Molecular Formula | C26H27FN6O |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridin-2-amine |
| SMILES | Fc1cccc(-c2noc(-c3ccc(NCCCN4CCN(c5ccccc5)CC4)nc3)n2)c1 |
| InChI | InChI=1S/C26H27FN6O/c27-22-7-4-6-20(18-22)25-30-26(34-31-25)21-10-11-24(29-19-21)28-12-5-13-32-14-16-33(17-15-32)23-8-2-1-3-9-23/h1-4,6-11,18-19H,5,12-17H2,(H,28,29) |
| InChIKey | GFAVDELFLXVKKL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|