C22H26FN5O — CID 95056750
5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]pyridin-2-amine (PubChem CID 95056750) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is 5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]pyridin-2-amine.
| Compound Name | 5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 95056750 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 5-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]pyridin-2-amine |
| SMILES | C[C@H]1CCCN(CCCNc2ccc(-c3nc(-c4cccc(F)c4)no3)cn2)C1 |
| InChI | InChI=1S/C22H26FN5O/c1-16-5-3-11-28(15-16)12-4-10-24-20-9-8-18(14-25-20)22-26-21(27-29-22)17-6-2-7-19(23)13-17/h2,6-9,13-14,16H,3-5,10-12,15H2,1H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | VBEMISLAEQGBCT-INIZCTEOSA-N |
| XLogP | 4.47 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|