C24H26N6O3S — CID 53127992
2-[[4-ethyl-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 53127992) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 53127992 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[[4-ethyl-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2c(C)cc(C)cc2C)nnc1-c1nc(-c2ccc(OC)cc2)no1 |
| InChI | InChI=1S/C24H26N6O3S/c1-6-30-22(23-26-21(29-33-23)17-7-9-18(32-5)10-8-17)27-28-24(30)34-13-19(31)25-20-15(3)11-14(2)12-16(20)4/h7-12H,6,13H2,1-5H3,(H,25,31) |
| InChIKey | NZAZBWLWMGLTMT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |