C25H31N5O4S — CID 1021751
N-[[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 1021751) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1021751 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(OC)c(OC)c2)nnc1SCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H31N5O4S/c1-7-30-21(13-26-24(32)18-8-9-19(33-5)20(12-18)34-6)28-29-25(30)35-14-22(31)27-23-16(3)10-15(2)11-17(23)4/h8-12H,7,13-14H2,1-6H3,(H,26,32)(H,27,31) |
| InChIKey | NJFFPNIPCAIMHJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |