C24H27Cl2N5O2S — CID 3630537
3,4-dichloro-N-[2-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 3630537) has the molecular formula C24H27Cl2N5O2S and a molecular weight of 520.49 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 3630537 |
| Molecular Formula | C24H27Cl2N5O2S |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 3,4-dichloro-N-[2-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | CCn1c(CCNC(=O)c2ccc(Cl)c(Cl)c2)nnc1SCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H27Cl2N5O2S/c1-5-31-20(8-9-27-23(33)17-6-7-18(25)19(26)12-17)29-30-24(31)34-13-21(32)28-22-15(3)10-14(2)11-16(22)4/h6-7,10-12H,5,8-9,13H2,1-4H3,(H,27,33)(H,28,32) |
| InChIKey | NLYGQULKRZDHAC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |