C25H28IN5O4S — CID 3431808
N-[[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 3431808) has the molecular formula C25H28IN5O4S and a molecular weight of 621.50 g/mol. Its IUPAC name is N-[[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3431808 |
| Molecular Formula | C25H28IN5O4S |
| Molecular Weight | 621.50 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | N-[[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccc(OC)c(OC)c2)nnc1SCC(=O)Nc1c(C)cc(I)cc1C |
| InChI | InChI=1S/C25H28IN5O4S/c1-6-9-31-21(13-27-24(33)17-7-8-19(34-4)20(12-17)35-5)29-30-25(31)36-14-22(32)28-23-15(2)10-18(26)11-16(23)3/h6-8,10-12H,1,9,13-14H2,2-5H3,(H,27,33)(H,28,32) |
| InChIKey | IRMHCKXRHZTHRR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|