C28H33N5O4S — CID 6255025
(E)-3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide (PubChem CID 6255025) has the molecular formula C28H33N5O4S and a molecular weight of 535.67 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 6255025 |
| Molecular Formula | C28H33N5O4S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=CCn1c(CNC(=O)/C=C/c2ccc(OC)c(OC)c2)nnc1SCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C28H33N5O4S/c1-7-12-33-24(16-29-25(34)11-9-21-8-10-22(36-5)23(15-21)37-6)31-32-28(33)38-17-26(35)30-27-19(3)13-18(2)14-20(27)4/h7-11,13-15H,1,12,16-17H2,2-6H3,(H,29,34)(H,30,35)/b11-9+ |
| InChIKey | KZFNTMJENNZIPI-PKNBQFBNSA-N |
| XLogP | 4.47 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|