C28H33N5O4S — CID 4684847
3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide (PubChem CID 4684847) has the molecular formula C28H33N5O4S and a molecular weight of 535.67 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 4684847 |
| Molecular Formula | C28H33N5O4S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[5-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=CCn1c(CNC(=O)C=Cc2ccc(OC)c(OC)c2)nnc1SCC(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H33N5O4S/c1-6-15-33-25(17-29-26(34)14-8-20-7-13-23(36-4)24(16-20)37-5)31-32-28(33)38-18-27(35)30-22-11-9-21(10-12-22)19(2)3/h6-14,16,19H,1,15,17-18H2,2-5H3,(H,29,34)(H,30,35) |
| InChIKey | SKDNNHXAVWNTFS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|