C18H34O5 — CID 5312877
(E)-5,8,12-trihydroxyoctadec-9-enoic acid (PubChem CID 5312877) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E)-5,8,12-trihydroxyoctadec-9-enoic acid.
| Compound Name | (E)-5,8,12-trihydroxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 5312877 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (E)-5,8,12-trihydroxyoctadec-9-enoic acid |
| SMILES | CCCCCCC(O)C/C=C/C(O)CCC(O)CCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-4-5-8-15(19)9-6-10-16(20)13-14-17(21)11-7-12-18(22)23/h6,10,15-17,19-21H,2-5,7-9,11-14H2,1H3,(H,22,23)/b10-6+ |
| InChIKey | LGADJSRSYLFTSG-UXBLZVDNSA-N |
| XLogP | 3.02 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|