C20H18FN3O2S — CID 53130184
N-(4-fluoro-3-methylphenyl)-2-[3-(2-methylphenoxy)pyrazin-2-yl]sulfanylacetamide (PubChem CID 53130184) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-2-[3-(2-methylphenoxy)pyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-2-[3-(2-methylphenoxy)pyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53130184 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-2-[3-(2-methylphenoxy)pyrazin-2-yl]sulfanylacetamide |
| SMILES | Cc1cc(NC(=O)CSc2nccnc2Oc2ccccc2C)ccc1F |
| InChI | InChI=1S/C20H18FN3O2S/c1-13-5-3-4-6-17(13)26-19-20(23-10-9-22-19)27-12-18(25)24-15-7-8-16(21)14(2)11-15/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | CGBMSXSNNQFNMC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |