C29H28N4O4 — CID 53132509
N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(3,4-dimethylphenyl)-3-oxo-1H-pyrazolo[4,3-c]quinoline-8-carboxamide (PubChem CID 53132509) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(3,4-dimethylphenyl)-3-oxo-1H-pyrazolo[4,3-c]quinoline-8-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(3,4-dimethylphenyl)-3-oxo-1H-pyrazolo[4,3-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 53132509 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(3,4-dimethylphenyl)-3-oxo-1H-pyrazolo[4,3-c]quinoline-8-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc3ncc4c(=O)n(-c5ccc(C)c(C)c5)[nH]c4c3c2)cc1OC |
| InChI | InChI=1S/C29H28N4O4/c1-16-6-9-21(12-17(16)2)33-29(35)23-15-30-24-10-7-20(13-22(24)27(23)32-33)28(34)31-18(3)19-8-11-25(36-4)26(14-19)37-5/h6-15,18,32H,1-5H3,(H,31,34) |
| InChIKey | ZILDOCKZVPURSR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|