C22H42OSi — CID 531338
tributyl(2,7-dimethyloct-7-en-5-yn-4-yloxy)silane (PubChem CID 531338) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is tributyl(2,7-dimethyloct-7-en-5-yn-4-yloxy)silane.
| Compound Name | tributyl(2,7-dimethyloct-7-en-5-yn-4-yloxy)silane |
|---|---|
| PubChem CID | 531338 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | tributyl(2,7-dimethyloct-7-en-5-yn-4-yloxy)silane |
| SMILES | C=C(C)C#CC(CC(C)C)O[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C22H42OSi/c1-8-11-16-24(17-12-9-2,18-13-10-3)23-22(19-21(6)7)15-14-20(4)5/h21-22H,4,8-13,16-19H2,1-3,5-7H3 |
| InChIKey | BZYJKIZVPXJJAP-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|