C18H25N3O5S — CID 53133800
3-[2-(4-methylphenyl)sulfonylethyl]-N-(3-propan-2-yloxypropyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 53133800) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[2-(4-methylphenyl)sulfonylethyl]-N-(3-propan-2-yloxypropyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[2-(4-methylphenyl)sulfonylethyl]-N-(3-propan-2-yloxypropyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 53133800 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-[2-(4-methylphenyl)sulfonylethyl]-N-(3-propan-2-yloxypropyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)CCc2noc(C(=O)NCCCOC(C)C)n2)cc1 |
| InChI | InChI=1S/C18H25N3O5S/c1-13(2)25-11-4-10-19-17(22)18-20-16(21-26-18)9-12-27(23,24)15-7-5-14(3)6-8-15/h5-8,13H,4,9-12H2,1-3H3,(H,19,22) |
| InChIKey | HEJYXHBPGHWRHW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|