C19H28N4O5S — CID 53133928
N-[3-(diethylamino)propyl]-3-[2-(4-methoxyphenyl)sulfonylethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 53133928) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-3-[2-(4-methoxyphenyl)sulfonylethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-3-[2-(4-methoxyphenyl)sulfonylethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 53133928 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[3-(diethylamino)propyl]-3-[2-(4-methoxyphenyl)sulfonylethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1nc(CCS(=O)(=O)c2ccc(OC)cc2)no1 |
| InChI | InChI=1S/C19H28N4O5S/c1-4-23(5-2)13-6-12-20-18(24)19-21-17(22-28-19)11-14-29(25,26)16-9-7-15(27-3)8-10-16/h7-10H,4-6,11-14H2,1-3H3,(H,20,24) |
| InChIKey | FVMUUMKYVNARGD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|