C21H29N3O3 — CID 53135470
1-[[4-(3-methylpiperidine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione (PubChem CID 53135470) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[[4-(3-methylpiperidine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione.
| Compound Name | 1-[[4-(3-methylpiperidine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 53135470 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[[4-(3-methylpiperidine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione |
| SMILES | CC1CCCN(C(=O)c2ccc(CN3CCN(C(C)C)C(=O)C3=O)cc2)C1 |
| InChI | InChI=1S/C21H29N3O3/c1-15(2)24-12-11-23(20(26)21(24)27)14-17-6-8-18(9-7-17)19(25)22-10-4-5-16(3)13-22/h6-9,15-16H,4-5,10-14H2,1-3H3 |
| InChIKey | ASUWVJRQBKISOL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|