C25H36N4O3 — CID 53135457
1-[[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione (PubChem CID 53135457) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-[[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione.
| Compound Name | 1-[[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 53135457 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-[[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]methyl]-4-propan-2-ylpiperazine-2,3-dione |
| SMILES | CC(C)N1CCN(Cc2ccc(C(=O)N3CCN(C4CCCCC4)CC3)cc2)C(=O)C1=O |
| InChI | InChI=1S/C25H36N4O3/c1-19(2)29-17-16-28(24(31)25(29)32)18-20-8-10-21(11-9-20)23(30)27-14-12-26(13-15-27)22-6-4-3-5-7-22/h8-11,19,22H,3-7,12-18H2,1-2H3 |
| InChIKey | GFKQYJUNQHSJRO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|